C28H33N7O4 — CID 166800358
4-N-[2-(dimethylamino)ethyl]-2-methoxy-1-N-[4-(7-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine (PubChem CID 166800358) has the molecular formula C28H33N7O4 and a molecular weight of 531.62 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-2-methoxy-1-N-[4-(7-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-2-methoxy-1-N-[4-(7-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 166800358 |
| Molecular Formula | C28H33N7O4 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-2-methoxy-1-N-[4-(7-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine |
| SMILES | COc1cc(NCCN(C)C)c([N+](=O)[O-])cc1Nc1nccc(-c2c3n(c4ccccc24)CC(OC)CC3)n1 |
| InChI | InChI=1S/C28H33N7O4/c1-33(2)14-13-29-21-16-26(39-4)22(15-25(21)35(36)37)32-28-30-12-11-20(31-28)27-19-7-5-6-8-23(19)34-17-18(38-3)9-10-24(27)34/h5-8,11-12,15-16,18,29H,9-10,13-14,17H2,1-4H3,(H,30,31,32) |
| InChIKey | ZUKLKVIWEAUCBF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|