C27H31N7O4 — CID 166800411
9-[2-[4-[2-(dimethylamino)ethylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1,2,3,4-tetrahydrocarbazol-3-ol (PubChem CID 166800411) has the molecular formula C27H31N7O4 and a molecular weight of 517.59 g/mol. Its IUPAC name is 9-[2-[4-[2-(dimethylamino)ethylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1,2,3,4-tetrahydrocarbazol-3-ol.
| Compound Name | 9-[2-[4-[2-(dimethylamino)ethylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1,2,3,4-tetrahydrocarbazol-3-ol |
|---|---|
| PubChem CID | 166800411 |
| Molecular Formula | C27H31N7O4 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 9-[2-[4-[2-(dimethylamino)ethylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1,2,3,4-tetrahydrocarbazol-3-ol |
| SMILES | COc1cc(NCCN(C)C)c([N+](=O)[O-])cc1Nc1nccc(-n2c3c(c4ccccc42)CC(O)CC3)n1 |
| InChI | InChI=1S/C27H31N7O4/c1-32(2)13-12-28-20-16-25(38-3)21(15-24(20)34(36)37)30-27-29-11-10-26(31-27)33-22-7-5-4-6-18(22)19-14-17(35)8-9-23(19)33/h4-7,10-11,15-17,28,35H,8-9,12-14H2,1-3H3,(H,29,30,31) |
| InChIKey | LEAPVXLYXRPTSV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|