About 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine
3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine (PubChem CID 166793725) has the molecular formula C13H15BrF2N4
and a molecular weight of 345.19 g/mol. Its IUPAC name is 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine |
| PubChem CID | 166793725 |
| Molecular Formula | C13H15BrF2N4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine |
| SMILES | CN(c1ccc2ncc(Br)n2n1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H15BrF2N4/c1-19(9-4-6-13(15,16)7-5-9)12-3-2-11-17-8-10(14)20(11)18-12/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | OZEBKGVHYANVKD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine?
The IUPAC name of 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine (CID 166793725) is 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine.
What is the SMILES notation for 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine?
The canonical SMILES for 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine is CN(c1ccc2ncc(Br)n2n1)C1CCC(F)(F)CC1.
What is the InChIKey of 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine?
The InChIKey is OZEBKGVHYANVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrF2N4/c1-19(9-4-6-13(15,16)7-5-9)12-3-2-11-17-8-10(14)20(11)18-12/h2-3,8-9H,4-7H2,1H3.
What are the key properties of 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine?
3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine has a molecular weight of 345.19 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(4,4-difluorocyclohexyl)-N-methylimidazo[1,2-b]pyridazin-6-amine is sourced from PubChem (CID 166793725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).