C27H27N5O3 — CID 166795010
3-[7-[(Z)-3-amino-4-(quinolin-4-ylmethylamino)but-3-enyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166795010) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 3-[7-[(Z)-3-amino-4-(quinolin-4-ylmethylamino)but-3-enyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[(Z)-3-amino-4-(quinolin-4-ylmethylamino)but-3-enyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166795010 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 3-[7-[(Z)-3-amino-4-(quinolin-4-ylmethylamino)but-3-enyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | N/C(=C\NCc1ccnc2ccccc12)CCc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C27H27N5O3/c28-19(15-29-14-18-12-13-30-23-7-2-1-5-20(18)23)9-8-17-4-3-6-21-22(17)16-32(27(21)35)24-10-11-25(33)31-26(24)34/h1-7,12-13,15,24,29H,8-11,14,16,28H2,(H,31,33,34)/b19-15- |
| InChIKey | DAGKNBVCBPOYDL-CYVLTUHYSA-N |
| XLogP | 2.52 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|