C17H29N — CID 166795221
(3Z,6E,9S,10Z)-2-ethyl-9-methyl-1-azacyclopentadeca-3,6,10-triene (PubChem CID 166795221) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is (3Z,6E,9S,10Z)-2-ethyl-9-methyl-1-azacyclopentadeca-3,6,10-triene.
| Compound Name | (3Z,6E,9S,10Z)-2-ethyl-9-methyl-1-azacyclopentadeca-3,6,10-triene |
|---|---|
| PubChem CID | 166795221 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | (3Z,6E,9S,10Z)-2-ethyl-9-methyl-1-azacyclopentadeca-3,6,10-triene |
| SMILES | CCC1/C=C\C/C=C/C[C@H](C)/C=C\CCCCN1 |
| InChI | InChI=1S/C17H29N/c1-3-17-14-10-5-4-8-12-16(2)13-9-6-7-11-15-18-17/h4,8-10,13-14,16-18H,3,5-7,11-12,15H2,1-2H3/b8-4+,13-9-,14-10-/t16-,17?/m0/s1 |
| InChIKey | CIHPMMDBCCQSMN-TYPRMZAHSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|