C18H29NO2 — CID 67708591
2-[(4Z,7E,10Z)-1-azacycloheptadeca-4,7,10-trien-2-yl]acetic acid (PubChem CID 67708591) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-[(4Z,7E,10Z)-1-azacycloheptadeca-4,7,10-trien-2-yl]acetic acid.
| Compound Name | 2-[(4Z,7E,10Z)-1-azacycloheptadeca-4,7,10-trien-2-yl]acetic acid |
|---|---|
| PubChem CID | 67708591 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-[(4Z,7E,10Z)-1-azacycloheptadeca-4,7,10-trien-2-yl]acetic acid |
| SMILES | O=C(O)CC1C/C=C\C/C=C/C/C=C\CCCCCCN1 |
| InChI | InChI=1S/C18H29NO2/c20-18(21)16-17-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-19-17/h1,3-4,6,10,12,17,19H,2,5,7-9,11,13-16H2,(H,20,21)/b3-1-,6-4+,12-10- |
| InChIKey | WLZRPDCSUJVQTE-YLJHOAQPSA-N |
| XLogP | 4.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|