C6H12N2O2 — CID 91095230
2-(1,3-diazinan-2-yl)acetic acid (PubChem CID 91095230) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-(1,3-diazinan-2-yl)acetic acid.
| Compound Name | 2-(1,3-diazinan-2-yl)acetic acid |
|---|---|
| PubChem CID | 91095230 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 2-(1,3-diazinan-2-yl)acetic acid |
| SMILES | O=C(O)CC1NCCCN1 |
| InChI | InChI=1S/C6H12N2O2/c9-6(10)4-5-7-2-1-3-8-5/h5,7-8H,1-4H2,(H,9,10) |
| InChIKey | CVTFZKSIFLQDJI-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |