C22H24N6O — CID 16679647
N-[[4-[8-amino-1-(1H-indol-2-yl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]formamide (PubChem CID 16679647) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is N-[[4-[8-amino-1-(1H-indol-2-yl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]formamide.
| Compound Name | N-[[4-[8-amino-1-(1H-indol-2-yl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]formamide |
|---|---|
| PubChem CID | 16679647 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[[4-[8-amino-1-(1H-indol-2-yl)imidazo[1,5-a]pyrazin-3-yl]cyclohexyl]methyl]formamide |
| SMILES | Nc1nccn2c(C3CCC(CNC=O)CC3)nc(-c3cc4ccccc4[nH]3)c12 |
| InChI | InChI=1S/C22H24N6O/c23-21-20-19(18-11-16-3-1-2-4-17(16)26-18)27-22(28(20)10-9-25-21)15-7-5-14(6-8-15)12-24-13-29/h1-4,9-11,13-15,26H,5-8,12H2,(H2,23,25)(H,24,29) |
| InChIKey | RDVARHXVHVSTSD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|