C8H16F2N2OS — CID 166799719
1-[4-(2,2-difluoroethyl)morpholin-2-yl]-N-methylsulfanylmethanamine (PubChem CID 166799719) has the molecular formula C8H16F2N2OS and a molecular weight of 226.29 g/mol. Its IUPAC name is 1-[4-(2,2-difluoroethyl)morpholin-2-yl]-N-methylsulfanylmethanamine.
| Compound Name | 1-[4-(2,2-difluoroethyl)morpholin-2-yl]-N-methylsulfanylmethanamine |
|---|---|
| PubChem CID | 166799719 |
| Molecular Formula | C8H16F2N2OS |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-[4-(2,2-difluoroethyl)morpholin-2-yl]-N-methylsulfanylmethanamine |
| SMILES | CSNCC1CN(CC(F)F)CCO1 |
| InChI | InChI=1S/C8H16F2N2OS/c1-14-11-4-7-5-12(2-3-13-7)6-8(9)10/h7-8,11H,2-6H2,1H3 |
| InChIKey | APVNAQRRXLMFIW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|