C15H33N3O — CID 166800661
N,2-dimethyl-N-[[(2S)-4-[2-(propylamino)ethyl]morpholin-2-yl]methyl]propan-1-amine (PubChem CID 166800661) has the molecular formula C15H33N3O and a molecular weight of 271.45 g/mol. Its IUPAC name is N,2-dimethyl-N-[[(2S)-4-[2-(propylamino)ethyl]morpholin-2-yl]methyl]propan-1-amine.
| Compound Name | N,2-dimethyl-N-[[(2S)-4-[2-(propylamino)ethyl]morpholin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 166800661 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | N,2-dimethyl-N-[[(2S)-4-[2-(propylamino)ethyl]morpholin-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCCN1CCO[C@@H](CN(C)CC(C)C)C1 |
| InChI | InChI=1S/C15H33N3O/c1-5-6-16-7-8-18-9-10-19-15(13-18)12-17(4)11-14(2)3/h14-16H,5-13H2,1-4H3/t15-/m0/s1 |
| InChIKey | QLJFMXKWNKDOCL-HNNXBMFYSA-N |
| XLogP | 1.27 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|