C15H31N3O2S — CID 167243582
N-methyl-N-[[(2R)-4-[2-(2-methylpropylamino)ethyl]morpholin-2-yl]methyl]-2-sulfanylpropanamide (PubChem CID 167243582) has the molecular formula C15H31N3O2S and a molecular weight of 317.50 g/mol. Its IUPAC name is N-methyl-N-[[(2R)-4-[2-(2-methylpropylamino)ethyl]morpholin-2-yl]methyl]-2-sulfanylpropanamide.
| Compound Name | N-methyl-N-[[(2R)-4-[2-(2-methylpropylamino)ethyl]morpholin-2-yl]methyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 167243582 |
| Molecular Formula | C15H31N3O2S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-methyl-N-[[(2R)-4-[2-(2-methylpropylamino)ethyl]morpholin-2-yl]methyl]-2-sulfanylpropanamide |
| SMILES | CC(C)CNCCN1CCO[C@@H](CN(C)C(=O)C(C)S)C1 |
| InChI | InChI=1S/C15H31N3O2S/c1-12(2)9-16-5-6-18-7-8-20-14(11-18)10-17(4)15(19)13(3)21/h12-14,16,21H,5-11H2,1-4H3/t13?,14-/m0/s1 |
| InChIKey | QALGOJDOCIKISB-KZUDCZAMSA-N |
| XLogP | 0.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|