C17H32N2O2 — CID 157327829
N,2-dimethyl-N-[[(2S)-4-(4-methylpent-2-ynyl)morpholin-2-yl]methyl]propanamide;methane (PubChem CID 157327829) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is N,2-dimethyl-N-[[(2S)-4-(4-methylpent-2-ynyl)morpholin-2-yl]methyl]propanamide;methane.
| Compound Name | N,2-dimethyl-N-[[(2S)-4-(4-methylpent-2-ynyl)morpholin-2-yl]methyl]propanamide;methane |
|---|---|
| PubChem CID | 157327829 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | N,2-dimethyl-N-[[(2S)-4-(4-methylpent-2-ynyl)morpholin-2-yl]methyl]propanamide;methane |
| SMILES | C.CC(C)C#CCN1CCO[C@H](CN(C)C(=O)C(C)C)C1 |
| InChI | InChI=1S/C16H28N2O2.CH4/c1-13(2)7-6-8-18-9-10-20-15(12-18)11-17(5)16(19)14(3)4;/h13-15H,8-12H2,1-5H3;1H4/t15-;/m1./s1 |
| InChIKey | BEYAWKYMBQHYNZ-XFULWGLBSA-N |
| XLogP | 2.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|