C24H44N2O2 — CID 166800725
N,2-dimethyl-N-[[(2R)-4-(4-methyloct-2-ynyl)morpholin-2-yl]methyl]octanamide (PubChem CID 166800725) has the molecular formula C24H44N2O2 and a molecular weight of 392.63 g/mol. Its IUPAC name is N,2-dimethyl-N-[[(2R)-4-(4-methyloct-2-ynyl)morpholin-2-yl]methyl]octanamide.
| Compound Name | N,2-dimethyl-N-[[(2R)-4-(4-methyloct-2-ynyl)morpholin-2-yl]methyl]octanamide |
|---|---|
| PubChem CID | 166800725 |
| Molecular Formula | C24H44N2O2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.34 |
| IUPAC Name | N,2-dimethyl-N-[[(2R)-4-(4-methyloct-2-ynyl)morpholin-2-yl]methyl]octanamide |
| SMILES | CCCCCCC(C)C(=O)N(C)C[C@H]1CN(CC#CC(C)CCCC)CCO1 |
| InChI | InChI=1S/C24H44N2O2/c1-6-8-10-11-15-22(4)24(27)25(5)19-23-20-26(17-18-28-23)16-12-14-21(3)13-9-7-2/h21-23H,6-11,13,15-20H2,1-5H3/t21?,22?,23-/m0/s1 |
| InChIKey | PHWOTDODPWJLFF-VNXZQDSDSA-N |
| XLogP | 4.58 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|