C34H24N2O6 — CID 16680218
1,2-bis(5-benzyl-[1,3]dioxolo[4,5-f]indol-6-yl)ethane-1,2-dione (PubChem CID 16680218) has the molecular formula C34H24N2O6 and a molecular weight of 556.57 g/mol. Its IUPAC name is 1,2-bis(5-benzyl-[1,3]dioxolo[4,5-f]indol-6-yl)ethane-1,2-dione.
| Compound Name | 1,2-bis(5-benzyl-[1,3]dioxolo[4,5-f]indol-6-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 16680218 |
| Molecular Formula | C34H24N2O6 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 1,2-bis(5-benzyl-[1,3]dioxolo[4,5-f]indol-6-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)c1cc2cc3c(cc2n1Cc1ccccc1)OCO3)c1cc2cc3c(cc2n1Cc1ccccc1)OCO3 |
| InChI | InChI=1S/C34H24N2O6/c37-33(27-11-23-13-29-31(41-19-39-29)15-25(23)35(27)17-21-7-3-1-4-8-21)34(38)28-12-24-14-30-32(42-20-40-30)16-26(24)36(28)18-22-9-5-2-6-10-22/h1-16H,17-20H2 |
| InChIKey | YZZFICWXZXSZJB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|