C22H28N2O2 — CID 166803197
N-hydroxy-4-[(6-propyl-3,4,5,6-tetrahydro-2H-1-benzazocin-1-yl)methyl]benzamide (PubChem CID 166803197) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-hydroxy-4-[(6-propyl-3,4,5,6-tetrahydro-2H-1-benzazocin-1-yl)methyl]benzamide.
| Compound Name | N-hydroxy-4-[(6-propyl-3,4,5,6-tetrahydro-2H-1-benzazocin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 166803197 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-hydroxy-4-[(6-propyl-3,4,5,6-tetrahydro-2H-1-benzazocin-1-yl)methyl]benzamide |
| SMILES | CCCC1CCCCN(Cc2ccc(C(=O)NO)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H28N2O2/c1-2-7-18-8-5-6-15-24(21-10-4-3-9-20(18)21)16-17-11-13-19(14-12-17)22(25)23-26/h3-4,9-14,18,26H,2,5-8,15-16H2,1H3,(H,23,25) |
| InChIKey | YPZPBPCXZZEBDF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|