C23H26N2O4 — CID 166804578
1-[4-[3-[3-tert-butyl-4-(ethoxymethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]ethanone (PubChem CID 166804578) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-[4-[3-[3-tert-butyl-4-(ethoxymethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]ethanone.
| Compound Name | 1-[4-[3-[3-tert-butyl-4-(ethoxymethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 166804578 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[4-[3-[3-tert-butyl-4-(ethoxymethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]ethanone |
| SMILES | CCOCOc1ccc(-c2noc(-c3ccc(C(C)=O)cc3)n2)cc1C(C)(C)C |
| InChI | InChI=1S/C23H26N2O4/c1-6-27-14-28-20-12-11-18(13-19(20)23(3,4)5)21-24-22(29-25-21)17-9-7-16(8-10-17)15(2)26/h7-13H,6,14H2,1-5H3 |
| InChIKey | ATZUTSGDNZXHJI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|