C14H26ClN3O4 — CID 172851283
3-tert-butyl-4-(ethoxymethoxy)-N'-hydroxybenzenecarboximidamide;hydroxylamine;hydrochloride (PubChem CID 172851283) has the molecular formula C14H26ClN3O4 and a molecular weight of 335.83 g/mol. Its IUPAC name is 3-tert-butyl-4-(ethoxymethoxy)-N'-hydroxybenzenecarboximidamide;hydroxylamine;hydrochloride.
| Compound Name | 3-tert-butyl-4-(ethoxymethoxy)-N'-hydroxybenzenecarboximidamide;hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 172851283 |
| Molecular Formula | C14H26ClN3O4 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3-tert-butyl-4-(ethoxymethoxy)-N'-hydroxybenzenecarboximidamide;hydroxylamine;hydrochloride |
| SMILES | CCOCOc1ccc(C(N)=NO)cc1C(C)(C)C.Cl.NO |
| InChI | InChI=1S/C14H22N2O3.ClH.H3NO/c1-5-18-9-19-12-7-6-10(13(15)16-17)8-11(12)14(2,3)4;;1-2/h6-8,17H,5,9H2,1-4H3,(H2,15,16);1H;2H,1H2 |
| InChIKey | YCHISDXIDMLWHW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|