C14H14N2S — CID 166806582
9-methylimino-5,10a-dihydrothioxanthen-1-amine (PubChem CID 166806582) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 9-methylimino-5,10a-dihydrothioxanthen-1-amine.
| Compound Name | 9-methylimino-5,10a-dihydrothioxanthen-1-amine |
|---|---|
| PubChem CID | 166806582 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 9-methylimino-5,10a-dihydrothioxanthen-1-amine |
| SMILES | C/N=C1\C2=CC=CCC2Sc2cccc(N)c21 |
| InChI | InChI=1S/C14H14N2S/c1-16-14-9-5-2-3-7-11(9)17-12-8-4-6-10(15)13(12)14/h2-6,8,11H,7,15H2,1H3/b16-14+ |
| InChIKey | FMERITQPULTLHK-JQIJEIRASA-N |
| XLogP | 3.05 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|