About 9-methylimino-5,10a-dihydrothioxanthen-1-amine
9-methylimino-5,10a-dihydrothioxanthen-1-amine (PubChem CID 166806582) has the molecular formula C14H14N2S
and a molecular weight of 242.35 g/mol. Its IUPAC name is 9-methylimino-5,10a-dihydrothioxanthen-1-amine.
Molecular Properties
| Compound Name | 9-methylimino-5,10a-dihydrothioxanthen-1-amine |
| PubChem CID | 166806582 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 9-methylimino-5,10a-dihydrothioxanthen-1-amine |
| SMILES | C/N=C1\C2=CC=CCC2Sc2cccc(N)c21 |
| InChI | InChI=1S/C14H14N2S/c1-16-14-9-5-2-3-7-11(9)17-12-8-4-6-10(15)13(12)14/h2-6,8,11H,7,15H2,1H3/b16-14+ |
| InChIKey | FMERITQPULTLHK-JQIJEIRASA-N |
| XLogP | 3.05 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 9-methylimino-5,10a-dihydrothioxanthen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylimino-5,10a-dihydrothioxanthen-1-amine?
The IUPAC name of 9-methylimino-5,10a-dihydrothioxanthen-1-amine (CID 166806582) is 9-methylimino-5,10a-dihydrothioxanthen-1-amine.
What is the SMILES notation for 9-methylimino-5,10a-dihydrothioxanthen-1-amine?
The canonical SMILES for 9-methylimino-5,10a-dihydrothioxanthen-1-amine is C/N=C1\C2=CC=CCC2Sc2cccc(N)c21.
What is the InChIKey of 9-methylimino-5,10a-dihydrothioxanthen-1-amine?
The InChIKey is FMERITQPULTLHK-JQIJEIRASA-N. The full InChI is InChI=1S/C14H14N2S/c1-16-14-9-5-2-3-7-11(9)17-12-8-4-6-10(15)13(12)14/h2-6,8,11H,7,15H2,1H3/b16-14+.
What are the key properties of 9-methylimino-5,10a-dihydrothioxanthen-1-amine?
9-methylimino-5,10a-dihydrothioxanthen-1-amine has a molecular weight of 242.35 g/mol, XLogP of 3.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylimino-5,10a-dihydrothioxanthen-1-amine is sourced from PubChem (CID 166806582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).