C13H15N — CID 91151311
10-methyl-9,10-dihydrobenzo[8]annulen-1-amine (PubChem CID 91151311) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 10-methyl-9,10-dihydrobenzo[8]annulen-1-amine.
| Compound Name | 10-methyl-9,10-dihydrobenzo[8]annulen-1-amine |
|---|---|
| PubChem CID | 91151311 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 10-methyl-9,10-dihydrobenzo[8]annulen-1-amine |
| SMILES | CC1CC=CC=Cc2cccc(N)c21 |
| InChI | InChI=1S/C13H15N/c1-10-6-3-2-4-7-11-8-5-9-12(14)13(10)11/h2-5,7-10H,6,14H2,1H3 |
| InChIKey | UJRZGFWZAGAWHW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|