C15H16 — CID 123289804
4-methyl-3,4,5,6-tetrahydrophenanthrene (PubChem CID 123289804) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is 4-methyl-3,4,5,6-tetrahydrophenanthrene.
| Compound Name | 4-methyl-3,4,5,6-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 123289804 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-methyl-3,4,5,6-tetrahydrophenanthrene |
| SMILES | CC1CC=Cc2ccc3c(c21)CCC=C3 |
| InChI | InChI=1S/C15H16/c1-11-5-4-7-13-10-9-12-6-2-3-8-14(12)15(11)13/h2,4,6-7,9-11H,3,5,8H2,1H3 |
| InChIKey | NMCWMQPPDUSHIA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |