C12H16ClN — CID 169449547
(1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride (PubChem CID 169449547) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride.
| Compound Name | (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 169449547 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride |
| SMILES | C[C@@H](N)c1cccc2c1CCC=C2.Cl |
| InChI | InChI=1S/C12H15N.ClH/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;/h2,4-6,8-9H,3,7,13H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | ZEUSAQNBTBAQMZ-SBSPUUFOSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |