About (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride
(1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride (PubChem CID 169449547) has the molecular formula C12H16ClN
and a molecular weight of 209.72 g/mol. Its IUPAC name is (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride |
| PubChem CID | 169449547 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride |
| SMILES | C[C@@H](N)c1cccc2c1CCC=C2.Cl |
| InChI | InChI=1S/C12H15N.ClH/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;/h2,4-6,8-9H,3,7,13H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | ZEUSAQNBTBAQMZ-SBSPUUFOSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride?
The IUPAC name of (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride (CID 169449547) is (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride.
What is the SMILES notation for (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride?
The canonical SMILES for (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride is C[C@@H](N)c1cccc2c1CCC=C2.Cl.
What is the InChIKey of (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride?
The InChIKey is ZEUSAQNBTBAQMZ-SBSPUUFOSA-N. The full InChI is InChI=1S/C12H15N.ClH/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;/h2,4-6,8-9H,3,7,13H2,1H3;1H/t9-;/m1./s1.
What are the key properties of (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride?
(1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride has a molecular weight of 209.72 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(7,8-dihydronaphthalen-1-yl)ethanamine;hydrochloride is sourced from PubChem (CID 169449547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).