C16H16 — CID 123770544
4,7-dimethyl-3,4-dihydrophenanthrene (PubChem CID 123770544) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 4,7-dimethyl-3,4-dihydrophenanthrene.
| Compound Name | 4,7-dimethyl-3,4-dihydrophenanthrene |
|---|---|
| PubChem CID | 123770544 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 4,7-dimethyl-3,4-dihydrophenanthrene |
| SMILES | Cc1ccc2c3c(ccc2c1)C=CCC3C |
| InChI | InChI=1S/C16H16/c1-11-6-9-15-14(10-11)8-7-13-5-3-4-12(2)16(13)15/h3,5-10,12H,4H2,1-2H3 |
| InChIKey | NOOXCTVWNJVCAP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |