C16H19N — CID 142206508
9-ethyl-4,6-dimethyl-3,4-dihydrocarbazole (PubChem CID 142206508) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is 9-ethyl-4,6-dimethyl-3,4-dihydrocarbazole.
| Compound Name | 9-ethyl-4,6-dimethyl-3,4-dihydrocarbazole |
|---|---|
| PubChem CID | 142206508 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 9-ethyl-4,6-dimethyl-3,4-dihydrocarbazole |
| SMILES | CCn1c2c(c3cc(C)ccc31)C(C)CC=C2 |
| InChI | InChI=1S/C16H19N/c1-4-17-14-9-8-11(2)10-13(14)16-12(3)6-5-7-15(16)17/h5,7-10,12H,4,6H2,1-3H3 |
| InChIKey | SSWBASICKLKELX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |