C45H44N2S — CID 144626590
2-[(Z)-1-(2,4-dimethylphenyl)-2-(9-ethylcarbazol-3-yl)prop-1-enyl]-N,9-dimethyl-N-phenyl-2,3,8,9-tetrahydrobenzo[g][1]benzothiol-3-amine (PubChem CID 144626590) has the molecular formula C45H44N2S and a molecular weight of 644.93 g/mol. Its IUPAC name is 2-[(Z)-1-(2,4-dimethylphenyl)-2-(9-ethylcarbazol-3-yl)prop-1-enyl]-N,9-dimethyl-N-phenyl-2,3,8,9-tetrahydrobenzo[g][1]benzothiol-3-amine.
| Compound Name | 2-[(Z)-1-(2,4-dimethylphenyl)-2-(9-ethylcarbazol-3-yl)prop-1-enyl]-N,9-dimethyl-N-phenyl-2,3,8,9-tetrahydrobenzo[g][1]benzothiol-3-amine |
|---|---|
| PubChem CID | 144626590 |
| Molecular Formula | C45H44N2S |
| Molecular Weight | 644.93 g/mol |
| Exact Mass | 644.32 |
| IUPAC Name | 2-[(Z)-1-(2,4-dimethylphenyl)-2-(9-ethylcarbazol-3-yl)prop-1-enyl]-N,9-dimethyl-N-phenyl-2,3,8,9-tetrahydrobenzo[g][1]benzothiol-3-amine |
| SMILES | CCn1c2ccccc2c2cc(/C(C)=C(/c3ccc(C)cc3C)C3Sc4c(ccc5c4C(C)CC=C5)C3N(C)c3ccccc3)ccc21 |
| InChI | InChI=1S/C45H44N2S/c1-7-47-39-19-12-11-18-36(39)38-27-33(22-25-40(38)47)31(5)42(35-23-20-28(2)26-30(35)4)45-43(46(6)34-16-9-8-10-17-34)37-24-21-32-15-13-14-29(3)41(32)44(37)48-45/h8-13,15-27,29,43,45H,7,14H2,1-6H3/b42-31- |
| InChIKey | HHEQBTAYOCESRS-QZJDNAQXSA-N |
| XLogP | 12.23 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.93 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|