About 1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine
1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine (PubChem CID 166806953) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine.
Analyze 1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine (CID 166806953) is 1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine is CCOCC1(CN(C)C)CC1.
What is the InChIKey of 1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine?
The InChIKey is RSLQWAJACWBYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-4-11-8-9(5-6-9)7-10(2)3/h4-8H2,1-3H3.
What are the key properties of 1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine?
1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine has a molecular weight of 157.26 g/mol, XLogP of 1.36, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(ethoxymethyl)cyclopropyl]-N,N-dimethylmethanamine is sourced from PubChem (CID 166806953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).