C22H28N4O — CID 166807481
5-[[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-1,4-diazepan-1-yl]methyl]-3-phenyl-1,2,4-oxadiazole (PubChem CID 166807481) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 5-[[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-1,4-diazepan-1-yl]methyl]-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-[[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-1,4-diazepan-1-yl]methyl]-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 166807481 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 5-[[4-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-1,4-diazepan-1-yl]methyl]-3-phenyl-1,2,4-oxadiazole |
| SMILES | C=C/C=C\C(=C/C)CN1CCCN(Cc2nc(-c3ccccc3)no2)CC1 |
| InChI | InChI=1S/C22H28N4O/c1-3-5-10-19(4-2)17-25-13-9-14-26(16-15-25)18-21-23-22(24-27-21)20-11-7-6-8-12-20/h3-8,10-12H,1,9,13-18H2,2H3/b10-5-,19-4+ |
| InChIKey | BZSLXSGAZYBUKN-KFLRBXAUSA-N |
| XLogP | 3.93 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|