C31H38N8O5 — CID 166807891
4-[[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-N-[(3R)-3-[(5-propylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]butanamide (PubChem CID 166807891) has the molecular formula C31H38N8O5 and a molecular weight of 602.70 g/mol. Its IUPAC name is 4-[[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-N-[(3R)-3-[(5-propylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]butanamide.
| Compound Name | 4-[[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-N-[(3R)-3-[(5-propylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]butanamide |
|---|---|
| PubChem CID | 166807891 |
| Molecular Formula | C31H38N8O5 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | 4-[[2-(2-hydroxy-6-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-N-[(3R)-3-[(5-propylpyrazolo[1,5-a]pyrimidin-7-yl)amino]cyclopentyl]butanamide |
| SMILES | CCCc1cc(N[C@@H]2CCC(NC(=O)CCCNc3cccc4c3C(=O)N(C3CCC(=O)NC3O)C4=O)C2)n2nccc2n1 |
| InChI | InChI=1S/C31H38N8O5/c1-2-5-18-17-25(39-24(34-18)13-15-33-39)35-19-9-10-20(16-19)36-26(40)8-4-14-32-22-7-3-6-21-28(22)31(44)38(30(21)43)23-11-12-27(41)37-29(23)42/h3,6-7,13,15,17,19-20,23,29,32,35,42H,2,4-5,8-12,14,16H2,1H3,(H,36,40)(H,37,41)/t19-,20?,23?,29?/m1/s1 |
| InChIKey | HVSJABDZKNZLTI-KJLZZGFVSA-N |
| XLogP | 2.22 |
| TPSA | 170.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|