C21H39NO4 — CID 166809353
[2,4-dimethyl-4-(2,2,4-trimethylpentylcarbamoyloxymethyl)hexan-2-yl] prop-2-enoate (PubChem CID 166809353) has the molecular formula C21H39NO4 and a molecular weight of 369.55 g/mol. Its IUPAC name is [2,4-dimethyl-4-(2,2,4-trimethylpentylcarbamoyloxymethyl)hexan-2-yl] prop-2-enoate.
| Compound Name | [2,4-dimethyl-4-(2,2,4-trimethylpentylcarbamoyloxymethyl)hexan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 166809353 |
| Molecular Formula | C21H39NO4 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | [2,4-dimethyl-4-(2,2,4-trimethylpentylcarbamoyloxymethyl)hexan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)CC(C)(CC)COC(=O)NCC(C)(C)CC(C)C |
| InChI | InChI=1S/C21H39NO4/c1-10-17(23)26-20(7,8)13-21(9,11-2)15-25-18(24)22-14-19(5,6)12-16(3)4/h10,16H,1,11-15H2,2-9H3,(H,22,24) |
| InChIKey | MBYIXHFXJHKXNZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|