C26H22FN7OS — CID 166810134
N-(2-amino-4-fluorophenyl)-4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]sulfanylmethyl]benzamide (PubChem CID 166810134) has the molecular formula C26H22FN7OS and a molecular weight of 499.58 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]sulfanylmethyl]benzamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 166810134 |
| Molecular Formula | C26H22FN7OS |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]sulfanylmethyl]benzamide |
| SMILES | Cc1cc(Nc2nc(SCc3ccc(C(=O)Nc4ccc(F)cc4N)cc3)nc3ccccc23)n[nH]1 |
| InChI | InChI=1S/C26H22FN7OS/c1-15-12-23(34-33-15)31-24-19-4-2-3-5-21(19)30-26(32-24)36-14-16-6-8-17(9-7-16)25(35)29-22-11-10-18(27)13-20(22)28/h2-13H,14,28H2,1H3,(H,29,35)(H2,30,31,32,33,34) |
| InChIKey | QHVDCRNODAZXPS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|