C23H22FN7O — CID 166810141
N-(2-amino-4-fluorophenyl)-4-[[[4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyridinyl]amino]methyl]benzamide (PubChem CID 166810141) has the molecular formula C23H22FN7O and a molecular weight of 431.48 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-4-[[[4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyridinyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-4-[[[4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyridinyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 166810141 |
| Molecular Formula | C23H22FN7O |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-4-[[[4-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyridinyl]amino]methyl]benzamide |
| SMILES | Cc1cc(Nc2ccnc(NCc3ccc(C(=O)Nc4ccc(F)cc4N)cc3)c2)n[nH]1 |
| InChI | InChI=1S/C23H22FN7O/c1-14-10-22(31-30-14)28-18-8-9-26-21(12-18)27-13-15-2-4-16(5-3-15)23(32)29-20-7-6-17(24)11-19(20)25/h2-12H,13,25H2,1H3,(H,29,32)(H3,26,27,28,30,31) |
| InChIKey | KLHZMFWNCQYRIM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|