C12H20F2N2O — CID 166810685
(2E,4Z)-2-(aminomethyl)-N-(3,3-difluorobutyl)-N-methylhexa-2,4-dienamide (PubChem CID 166810685) has the molecular formula C12H20F2N2O and a molecular weight of 246.30 g/mol. Its IUPAC name is (2E,4Z)-2-(aminomethyl)-N-(3,3-difluorobutyl)-N-methylhexa-2,4-dienamide.
| Compound Name | (2E,4Z)-2-(aminomethyl)-N-(3,3-difluorobutyl)-N-methylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 166810685 |
| Molecular Formula | C12H20F2N2O |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2E,4Z)-2-(aminomethyl)-N-(3,3-difluorobutyl)-N-methylhexa-2,4-dienamide |
| SMILES | C/C=C\C=C(/CN)C(=O)N(C)CCC(C)(F)F |
| InChI | InChI=1S/C12H20F2N2O/c1-4-5-6-10(9-15)11(17)16(3)8-7-12(2,13)14/h4-6H,7-9,15H2,1-3H3/b5-4-,10-6+ |
| InChIKey | APWGNBDWWXKGGQ-VWJYOPCBSA-N |
| XLogP | 1.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|