C8H11FN2O — CID 105434427
3-(aminomethyl)-5-fluoro-1,6-dimethylpyridin-2-one (PubChem CID 105434427) has the molecular formula C8H11FN2O and a molecular weight of 170.19 g/mol. Its IUPAC name is 3-(aminomethyl)-5-fluoro-1,6-dimethylpyridin-2-one.
| Compound Name | 3-(aminomethyl)-5-fluoro-1,6-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 105434427 |
| Molecular Formula | C8H11FN2O |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 3-(aminomethyl)-5-fluoro-1,6-dimethylpyridin-2-one |
| SMILES | Cc1c(F)cc(CN)c(=O)n1C |
| InChI | InChI=1S/C8H11FN2O/c1-5-7(9)3-6(4-10)8(12)11(5)2/h3H,4,10H2,1-2H3 |
| InChIKey | HPQMLNLDAYOKBH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |