About 3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one
3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one (PubChem CID 90102403) has the molecular formula C9H13FN2O
and a molecular weight of 184.21 g/mol. Its IUPAC name is 3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one.
Analyze 3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one?
The IUPAC name of 3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one (CID 90102403) is 3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one.
What is the SMILES notation for 3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one?
The canonical SMILES for 3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one is Cc1c(F)c(C)n(C)c(=O)c1CN.
What is the InChIKey of 3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one?
The InChIKey is FNUNFHKOYFJBSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FN2O/c1-5-7(4-11)9(13)12(3)6(2)8(5)10/h4,11H2,1-3H3.
What are the key properties of 3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one?
3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one has a molecular weight of 184.21 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-5-fluoro-1,4,6-trimethylpyridin-2-one is sourced from PubChem (CID 90102403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).