C19H23N3O5 — CID 166812548
methyl 4-[[4-(2-methoxy-2-oxoethyl)-1-oxophthalazin-2-yl]methyl]piperidine-1-carboxylate (PubChem CID 166812548) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is methyl 4-[[4-(2-methoxy-2-oxoethyl)-1-oxophthalazin-2-yl]methyl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[4-(2-methoxy-2-oxoethyl)-1-oxophthalazin-2-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166812548 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | methyl 4-[[4-(2-methoxy-2-oxoethyl)-1-oxophthalazin-2-yl]methyl]piperidine-1-carboxylate |
| SMILES | COC(=O)Cc1nn(CC2CCN(C(=O)OC)CC2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H23N3O5/c1-26-17(23)11-16-14-5-3-4-6-15(14)18(24)22(20-16)12-13-7-9-21(10-8-13)19(25)27-2/h3-6,13H,7-12H2,1-2H3 |
| InChIKey | LQYLGQDNHREROI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |