C25H20ClNO4 — CID 166813322
5-[(5-chloro-6-phenylmethoxycarbonyl-1H-indol-2-yl)methyl]-2-methylbenzoic acid (PubChem CID 166813322) has the molecular formula C25H20ClNO4 and a molecular weight of 433.89 g/mol. Its IUPAC name is 5-[(5-chloro-6-phenylmethoxycarbonyl-1H-indol-2-yl)methyl]-2-methylbenzoic acid.
| Compound Name | 5-[(5-chloro-6-phenylmethoxycarbonyl-1H-indol-2-yl)methyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 166813322 |
| Molecular Formula | C25H20ClNO4 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 5-[(5-chloro-6-phenylmethoxycarbonyl-1H-indol-2-yl)methyl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(Cc2cc3cc(Cl)c(C(=O)OCc4ccccc4)cc3[nH]2)cc1C(=O)O |
| InChI | InChI=1S/C25H20ClNO4/c1-15-7-8-17(10-20(15)24(28)29)9-19-11-18-12-22(26)21(13-23(18)27-19)25(30)31-14-16-5-3-2-4-6-16/h2-8,10-13,27H,9,14H2,1H3,(H,28,29) |
| InChIKey | YKEICVZPUAIIRA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |