C9H14N6O6 — CID 166813992
5-azido-6-(2-azido-1-hydroxypropyl)-2,4-dihydroxyoxane-2-carboxylic acid (PubChem CID 166813992) has the molecular formula C9H14N6O6 and a molecular weight of 302.25 g/mol. Its IUPAC name is 5-azido-6-(2-azido-1-hydroxypropyl)-2,4-dihydroxyoxane-2-carboxylic acid.
| Compound Name | 5-azido-6-(2-azido-1-hydroxypropyl)-2,4-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 166813992 |
| Molecular Formula | C9H14N6O6 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-azido-6-(2-azido-1-hydroxypropyl)-2,4-dihydroxyoxane-2-carboxylic acid |
| SMILES | CC(N=[N+]=[N-])C(O)C1OC(O)(C(=O)O)CC(O)C1N=[N+]=[N-] |
| InChI | InChI=1S/C9H14N6O6/c1-3(12-14-10)6(17)7-5(13-15-11)4(16)2-9(20,21-7)8(18)19/h3-7,16-17,20H,2H2,1H3,(H,18,19) |
| InChIKey | DPBAPCUBUKZMEA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 204.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|