C25H25N3O2 — CID 166814484
2-imino-N-methyl-2-[3-methyl-2-[[(E)-1-(4-phenylphenyl)ethylideneamino]oxymethyl]phenyl]acetamide (PubChem CID 166814484) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-imino-N-methyl-2-[3-methyl-2-[[(E)-1-(4-phenylphenyl)ethylideneamino]oxymethyl]phenyl]acetamide.
| Compound Name | 2-imino-N-methyl-2-[3-methyl-2-[[(E)-1-(4-phenylphenyl)ethylideneamino]oxymethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 166814484 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-imino-N-methyl-2-[3-methyl-2-[[(E)-1-(4-phenylphenyl)ethylideneamino]oxymethyl]phenyl]acetamide |
| SMILES | [H]/N=C(\C(=O)NC)c1cccc(C)c1CO/N=C(\C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O2/c1-17-8-7-11-22(24(26)25(29)27-3)23(17)16-30-28-18(2)19-12-14-21(15-13-19)20-9-5-4-6-10-20/h4-15,26H,16H2,1-3H3,(H,27,29)/b26-24-,28-18+ |
| InChIKey | KWIBHHXNWXDYAC-KYZVJGMFSA-N |
| XLogP | 4.72 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|