C14H22NO2P — CID 166820358
[(4S)-3-[(4-methoxyphenoxy)methyl]-1-methylpiperidin-4-yl]phosphane (PubChem CID 166820358) has the molecular formula C14H22NO2P and a molecular weight of 267.31 g/mol. Its IUPAC name is [(4S)-3-[(4-methoxyphenoxy)methyl]-1-methylpiperidin-4-yl]phosphane.
| Compound Name | [(4S)-3-[(4-methoxyphenoxy)methyl]-1-methylpiperidin-4-yl]phosphane |
|---|---|
| PubChem CID | 166820358 |
| Molecular Formula | C14H22NO2P |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | [(4S)-3-[(4-methoxyphenoxy)methyl]-1-methylpiperidin-4-yl]phosphane |
| SMILES | COc1ccc(OCC2CN(C)CC[C@@H]2P)cc1 |
| InChI | InChI=1S/C14H22NO2P/c1-15-8-7-14(18)11(9-15)10-17-13-5-3-12(16-2)4-6-13/h3-6,11,14H,7-10,18H2,1-2H3/t11?,14-/m0/s1 |
| InChIKey | LMMUUOQDXQBDTH-IAXJKZSUSA-N |
| XLogP | 2.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|