C18H18F6N8O2 — CID 166822978
N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-a]pyrimidin-2-yl]methyl]-2-(3,3,3-trifluoropropyl)triazole-4-carboxamide (PubChem CID 166822978) has the molecular formula C18H18F6N8O2 and a molecular weight of 492.38 g/mol. Its IUPAC name is N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-a]pyrimidin-2-yl]methyl]-2-(3,3,3-trifluoropropyl)triazole-4-carboxamide.
| Compound Name | N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-a]pyrimidin-2-yl]methyl]-2-(3,3,3-trifluoropropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 166822978 |
| Molecular Formula | C18H18F6N8O2 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-a]pyrimidin-2-yl]methyl]-2-(3,3,3-trifluoropropyl)triazole-4-carboxamide |
| SMILES | O=C(CCC(F)(F)F)NCc1ccn2cc(CNC(=O)c3cnn(CCC(F)(F)F)n3)nc2n1 |
| InChI | InChI=1S/C18H18F6N8O2/c19-17(20,21)3-1-14(33)25-7-11-2-5-31-10-12(29-16(31)28-11)8-26-15(34)13-9-27-32(30-13)6-4-18(22,23)24/h2,5,9-10H,1,3-4,6-8H2,(H,25,33)(H,26,34) |
| InChIKey | WXCDLPVBZKWKFF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |