C28H21IO6 — CID 166823003
5-[(E)-2-[3-(3,5-dihydroxyphenyl)-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]ethenyl]-2-iodobenzene-1,3-diol (PubChem CID 166823003) has the molecular formula C28H21IO6 and a molecular weight of 580.37 g/mol. Its IUPAC name is 5-[(E)-2-[3-(3,5-dihydroxyphenyl)-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]ethenyl]-2-iodobenzene-1,3-diol.
| Compound Name | 5-[(E)-2-[3-(3,5-dihydroxyphenyl)-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]ethenyl]-2-iodobenzene-1,3-diol |
|---|---|
| PubChem CID | 166823003 |
| Molecular Formula | C28H21IO6 |
| Molecular Weight | 580.37 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | 5-[(E)-2-[3-(3,5-dihydroxyphenyl)-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]ethenyl]-2-iodobenzene-1,3-diol |
| SMILES | Oc1ccc(C2Oc3ccc(/C=C/c4cc(O)c(I)c(O)c4)cc3C2c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C28H21IO6/c29-27-23(33)10-16(11-24(27)34)2-1-15-3-8-25-22(9-15)26(18-12-20(31)14-21(32)13-18)28(35-25)17-4-6-19(30)7-5-17/h1-14,26,28,30-34H/b2-1+ |
| InChIKey | BPRHQHXQQWBJNT-OWOJBTEDSA-N |
| XLogP | 6.26 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.37 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|