C28H22O4 — CID 102321408
4-[(E)-2-[2,3-bis(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]ethenyl]phenol (PubChem CID 102321408) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is 4-[(E)-2-[2,3-bis(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]ethenyl]phenol.
| Compound Name | 4-[(E)-2-[2,3-bis(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]ethenyl]phenol |
|---|---|
| PubChem CID | 102321408 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-[(E)-2-[2,3-bis(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]ethenyl]phenol |
| SMILES | Oc1ccc(/C=C/c2ccc3c(c2)C(c2ccc(O)cc2)C(c2ccc(O)cc2)O3)cc1 |
| InChI | InChI=1S/C28H22O4/c29-22-10-3-18(4-11-22)1-2-19-5-16-26-25(17-19)27(20-6-12-23(30)13-7-20)28(32-26)21-8-14-24(31)15-9-21/h1-17,27-31H/b2-1+ |
| InChIKey | CGRCLHMQVSNERU-OWOJBTEDSA-N |
| XLogP | 6.24 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|