C20H18O4 — CID 102581346
(E)-4-[(2R,3R)-3-acetyl-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]but-3-en-2-one (PubChem CID 102581346) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is (E)-4-[(2R,3R)-3-acetyl-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]but-3-en-2-one.
| Compound Name | (E)-4-[(2R,3R)-3-acetyl-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 102581346 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (E)-4-[(2R,3R)-3-acetyl-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1ccc2c(c1)[C@@H](C(C)=O)[C@H](c1ccc(O)cc1)O2 |
| InChI | InChI=1S/C20H18O4/c1-12(21)3-4-14-5-10-18-17(11-14)19(13(2)22)20(24-18)15-6-8-16(23)9-7-15/h3-11,19-20,23H,1-2H3/b4-3+/t19-,20+/m1/s1 |
| InChIKey | DAEQUJXXJUWEPY-WGLWSTOQSA-N |
| XLogP | 3.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|