C24H28N4O5 — CID 24864116
methyl 5-[(E)-3-[4-(diaminomethylideneamino)butylamino]-3-oxoprop-1-enyl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-carboxylate (PubChem CID 24864116) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is methyl 5-[(E)-3-[4-(diaminomethylideneamino)butylamino]-3-oxoprop-1-enyl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-carboxylate.
| Compound Name | methyl 5-[(E)-3-[4-(diaminomethylideneamino)butylamino]-3-oxoprop-1-enyl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 24864116 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | methyl 5-[(E)-3-[4-(diaminomethylideneamino)butylamino]-3-oxoprop-1-enyl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)C1c2cc(/C=C/C(=O)NCCCCN=C(N)N)ccc2OC1c1ccc(O)cc1 |
| InChI | InChI=1S/C24H28N4O5/c1-32-23(31)21-18-14-15(5-11-20(30)27-12-2-3-13-28-24(25)26)4-10-19(18)33-22(21)16-6-8-17(29)9-7-16/h4-11,14,21-22,29H,2-3,12-13H2,1H3,(H,27,30)(H4,25,26,28)/b11-5+ |
| InChIKey | NUJFXJZNVREWNB-VZUCSPMQSA-N |
| XLogP | 1.97 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|