C29H39N7O4 — CID 152991950
(2R,3R)-N-[4-(1-aminoethenylamino)butyl]-5-[(E)-3-[4-(diaminomethylideneamino)butylamino]-3-oxoprop-1-enyl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-carboxamide (PubChem CID 152991950) has the molecular formula C29H39N7O4 and a molecular weight of 549.68 g/mol. Its IUPAC name is (2R,3R)-N-[4-(1-aminoethenylamino)butyl]-5-[(E)-3-[4-(diaminomethylideneamino)butylamino]-3-oxoprop-1-enyl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-carboxamide.
| Compound Name | (2R,3R)-N-[4-(1-aminoethenylamino)butyl]-5-[(E)-3-[4-(diaminomethylideneamino)butylamino]-3-oxoprop-1-enyl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 152991950 |
| Molecular Formula | C29H39N7O4 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | (2R,3R)-N-[4-(1-aminoethenylamino)butyl]-5-[(E)-3-[4-(diaminomethylideneamino)butylamino]-3-oxoprop-1-enyl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-carboxamide |
| SMILES | C=C(N)NCCCCNC(=O)[C@@H]1c2cc(/C=C/C(=O)NCCCCN=C(N)N)ccc2O[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C29H39N7O4/c1-19(30)33-14-2-4-16-35-28(39)26-23-18-20(7-13-25(38)34-15-3-5-17-36-29(31)32)6-12-24(23)40-27(26)21-8-10-22(37)11-9-21/h6-13,18,26-27,33,37H,1-5,14-17,30H2,(H,34,38)(H,35,39)(H4,31,32,36)/b13-7+/t26-,27+/m1/s1 |
| InChIKey | UWLKFZXSKLWXGB-KVZYTMNXSA-N |
| XLogP | 1.71 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|