C20H23F2N3O3 — CID 166823610
(2E)-2-[2-[[(2,2-difluoro-1-phenylethyl)amino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 166823610) has the molecular formula C20H23F2N3O3 and a molecular weight of 391.42 g/mol. Its IUPAC name is (2E)-2-[2-[[(2,2-difluoro-1-phenylethyl)amino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2E)-2-[2-[[(2,2-difluoro-1-phenylethyl)amino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 166823610 |
| Molecular Formula | C20H23F2N3O3 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (2E)-2-[2-[[(2,2-difluoro-1-phenylethyl)amino]oxymethyl]-3-methylphenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N/OC)c1cccc(C)c1CONC(c1ccccc1)C(F)F |
| InChI | InChI=1S/C20H23F2N3O3/c1-13-8-7-11-15(18(24-27-3)20(26)23-2)16(13)12-28-25-17(19(21)22)14-9-5-4-6-10-14/h4-11,17,19,25H,12H2,1-3H3,(H,23,26)/b24-18+ |
| InChIKey | YVSCFMQILHWLBR-HKOYGPOVSA-N |
| XLogP | 3.12 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|