C9H9F4N2O3P — CID 166824016
methyl N-[3-[fluoro(phosphanyl)methoxy]-5-(trifluoromethyl)-2-pyridinyl]carbamate (PubChem CID 166824016) has the molecular formula C9H9F4N2O3P and a molecular weight of 300.15 g/mol. Its IUPAC name is methyl N-[3-[fluoro(phosphanyl)methoxy]-5-(trifluoromethyl)-2-pyridinyl]carbamate.
| Compound Name | methyl N-[3-[fluoro(phosphanyl)methoxy]-5-(trifluoromethyl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 166824016 |
| Molecular Formula | C9H9F4N2O3P |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | methyl N-[3-[fluoro(phosphanyl)methoxy]-5-(trifluoromethyl)-2-pyridinyl]carbamate |
| SMILES | COC(=O)Nc1ncc(C(F)(F)F)cc1OC(F)P |
| InChI | InChI=1S/C9H9F4N2O3P/c1-17-8(16)15-6-5(18-7(10)19)2-4(3-14-6)9(11,12)13/h2-3,7H,19H2,1H3,(H,14,15,16) |
| InChIKey | XSFKAKJRNIOZKC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|