C17H32N4O — CID 166824543
4-tert-butyl-N'-[(E)-2,4,4-trimethyl-3-oxopent-1-enyl]piperazine-1-carboximidamide (PubChem CID 166824543) has the molecular formula C17H32N4O and a molecular weight of 308.47 g/mol. Its IUPAC name is 4-tert-butyl-N'-[(E)-2,4,4-trimethyl-3-oxopent-1-enyl]piperazine-1-carboximidamide.
| Compound Name | 4-tert-butyl-N'-[(E)-2,4,4-trimethyl-3-oxopent-1-enyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 166824543 |
| Molecular Formula | C17H32N4O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | 4-tert-butyl-N'-[(E)-2,4,4-trimethyl-3-oxopent-1-enyl]piperazine-1-carboximidamide |
| SMILES | C/C(=C\N=C(/N)N1CCN(C(C)(C)C)CC1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H32N4O/c1-13(14(22)16(2,3)4)12-19-15(18)20-8-10-21(11-9-20)17(5,6)7/h12H,8-11H2,1-7H3,(H2,18,19)/b13-12+ |
| InChIKey | GVUHOSVBOBHNLB-OUKQBFOZSA-N |
| XLogP | 2.24 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|