C21H34INO3 — CID 16682490
4-[[2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-4-methylmorpholin-4-ium iodide (PubChem CID 16682490) has the molecular formula C21H34INO3 and a molecular weight of 475.41 g/mol. Its IUPAC name is 4-[[2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-4-methylmorpholin-4-ium iodide.
| Compound Name | 4-[[2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-4-methylmorpholin-4-ium iodide |
|---|---|
| PubChem CID | 16682490 |
| Molecular Formula | C21H34INO3 |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 4-[[2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-4-methylmorpholin-4-ium iodide |
| SMILES | CC(C)(C)c1ccc(CCC2OCC(C[N+]3(C)CCOCC3)O2)cc1.[I-] |
| InChI | InChI=1S/C21H34NO3.HI/c1-21(2,3)18-8-5-17(6-9-18)7-10-20-24-16-19(25-20)15-22(4)11-13-23-14-12-22;/h5-6,8-9,19-20H,7,10-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | KGRJIYGEZIZODQ-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|