C18H24F3N7O2S — CID 166825829
(Z)-3-amino-2-aminosulfanyl-4-methyl-N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]pent-2-enamide (PubChem CID 166825829) has the molecular formula C18H24F3N7O2S and a molecular weight of 459.50 g/mol. Its IUPAC name is (Z)-3-amino-2-aminosulfanyl-4-methyl-N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]pent-2-enamide.
| Compound Name | (Z)-3-amino-2-aminosulfanyl-4-methyl-N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]pent-2-enamide |
|---|---|
| PubChem CID | 166825829 |
| Molecular Formula | C18H24F3N7O2S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (Z)-3-amino-2-aminosulfanyl-4-methyl-N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]pent-2-enamide |
| SMILES | CC(C)/C(N)=C(/SN)C(=O)NCc1cn2ncc(CNC(=O)CCC(F)(F)F)cc2n1 |
| InChI | InChI=1S/C18H24F3N7O2S/c1-10(2)15(22)16(31-23)17(30)25-8-12-9-28-13(27-12)5-11(7-26-28)6-24-14(29)3-4-18(19,20)21/h5,7,9-10H,3-4,6,8,22-23H2,1-2H3,(H,24,29)(H,25,30)/b16-15- |
| InChIKey | YIXZPOFVVZYEKX-NXVVXOECSA-N |
| XLogP | 1.74 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|