C19H23N — CID 166829377
N-methyl-2-(4-methylcyclohexa-1,5-dien-1-yl)-N-[(3Z)-penta-1,3-dien-2-yl]aniline (PubChem CID 166829377) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is N-methyl-2-(4-methylcyclohexa-1,5-dien-1-yl)-N-[(3Z)-penta-1,3-dien-2-yl]aniline.
| Compound Name | N-methyl-2-(4-methylcyclohexa-1,5-dien-1-yl)-N-[(3Z)-penta-1,3-dien-2-yl]aniline |
|---|---|
| PubChem CID | 166829377 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-methyl-2-(4-methylcyclohexa-1,5-dien-1-yl)-N-[(3Z)-penta-1,3-dien-2-yl]aniline |
| SMILES | C=C(/C=C\C)N(C)c1ccccc1C1=CCC(C)C=C1 |
| InChI | InChI=1S/C19H23N/c1-5-8-16(3)20(4)19-10-7-6-9-18(19)17-13-11-15(2)12-14-17/h5-11,13-15H,3,12H2,1-2,4H3/b8-5- |
| InChIKey | XPCAJHLULIZNJL-YVMONPNESA-N |
| XLogP | 5.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|